About 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine
1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine (PubChem CID 19362268) has the molecular formula C10H24N2O
and a molecular weight of 188.31 g/mol. Its IUPAC name is 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine |
| PubChem CID | 19362268 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine |
| SMILES | CC(COCC(C)N(C)C)N(C)C |
| InChI | InChI=1S/C10H24N2O/c1-9(11(3)4)7-13-8-10(2)12(5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | OSOKCJGGSKFIED-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine?
The IUPAC name of 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine (CID 19362268) is 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine.
What is the SMILES notation for 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine?
The canonical SMILES for 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine is CC(COCC(C)N(C)C)N(C)C.
What is the InChIKey of 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine?
The InChIKey is OSOKCJGGSKFIED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2O/c1-9(11(3)4)7-13-8-10(2)12(5)6/h9-10H,7-8H2,1-6H3.
What are the key properties of 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine?
1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine has a molecular weight of 188.31 g/mol, XLogP of 0.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(dimethylamino)propoxy]-N,N-dimethylpropan-2-amine is sourced from PubChem (CID 19362268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).