About N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine (PubChem CID 19362323) has the molecular formula C17H31N
and a molecular weight of 249.44 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine.
Molecular Properties
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine |
| PubChem CID | 19362323 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine |
| SMILES | CC(C)=CCC/C(C)=C/CN(C)C1CCCCC1 |
| InChI | InChI=1S/C17H31N/c1-15(2)9-8-10-16(3)13-14-18(4)17-11-6-5-7-12-17/h9,13,17H,5-8,10-12,14H2,1-4H3/b16-13+ |
| InChIKey | HJYDVRJPSRHYER-DTQAZKPQSA-N |
| XLogP | 4.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine?
The IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine (CID 19362323) is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine.
What is the SMILES notation for N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine?
The canonical SMILES for N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine is CC(C)=CCC/C(C)=C/CN(C)C1CCCCC1.
What is the InChIKey of N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine?
The InChIKey is HJYDVRJPSRHYER-DTQAZKPQSA-N. The full InChI is InChI=1S/C17H31N/c1-15(2)9-8-10-16(3)13-14-18(4)17-11-6-5-7-12-17/h9,13,17H,5-8,10-12,14H2,1-4H3/b16-13+.
What are the key properties of N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine?
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine has a molecular weight of 249.44 g/mol, XLogP of 4.94, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methylcyclohexanamine is sourced from PubChem (CID 19362323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).