C22H20N2 — CID 19362341
5,10-dimethyl-5,6,10,14b-tetrahydrophenanthro[9,10-b]quinoxaline (PubChem CID 19362341) has the molecular formula C22H20N2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 5,10-dimethyl-5,6,10,14b-tetrahydrophenanthro[9,10-b]quinoxaline.
| Compound Name | 5,10-dimethyl-5,6,10,14b-tetrahydrophenanthro[9,10-b]quinoxaline |
|---|---|
| PubChem CID | 19362341 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5,10-dimethyl-5,6,10,14b-tetrahydrophenanthro[9,10-b]quinoxaline |
| SMILES | CC1CC=CC2=c3nc4c(nc3C3C=CC=CC3=C21)=CC=CC4C |
| InChI | InChI=1S/C22H20N2/c1-13-7-5-11-17-19(13)15-9-3-4-10-16(15)21-22(17)24-20-14(2)8-6-12-18(20)23-21/h3-6,8-14,16H,7H2,1-2H3 |
| InChIKey | DKRWYLPREQTQIH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |