About 1-ethoxyethanol;hydrate
1-ethoxyethanol;hydrate (PubChem CID 19363080) has the molecular formula C4H12O3
and a molecular weight of 108.14 g/mol. Its IUPAC name is 1-ethoxyethanol;hydrate.
Molecular Properties
| Compound Name | 1-ethoxyethanol;hydrate |
| PubChem CID | 19363080 |
| Molecular Formula | C4H12O3 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.08 |
| IUPAC Name | 1-ethoxyethanol;hydrate |
| SMILES | CCOC(C)O.O |
| InChI | InChI=1S/C4H10O2.H2O/c1-3-6-4(2)5;/h4-5H,3H2,1-2H3;1H2 |
| InChIKey | ZGYVBBXPBVUIQN-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 60.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethanol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethanol;hydrate?
The IUPAC name of 1-ethoxyethanol;hydrate (CID 19363080) is 1-ethoxyethanol;hydrate.
What is the SMILES notation for 1-ethoxyethanol;hydrate?
The canonical SMILES for 1-ethoxyethanol;hydrate is CCOC(C)O.O.
What is the InChIKey of 1-ethoxyethanol;hydrate?
The InChIKey is ZGYVBBXPBVUIQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.H2O/c1-3-6-4(2)5;/h4-5H,3H2,1-2H3;1H2.
What are the key properties of 1-ethoxyethanol;hydrate?
1-ethoxyethanol;hydrate has a molecular weight of 108.14 g/mol, XLogP of -0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethanol;hydrate is sourced from PubChem (CID 19363080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).