About N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide
N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide (PubChem CID 19363251) has the molecular formula C25H35NO4
and a molecular weight of 413.56 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide.
Molecular Properties
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide |
| PubChem CID | 19363251 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)NCCc2ccc(O)cc2)cc1OCCCCC |
| InChI | InChI=1S/C25H35NO4/c1-3-5-7-17-29-23-14-11-21(19-24(23)30-18-8-6-4-2)25(28)26-16-15-20-9-12-22(27)13-10-20/h9-14,19,27H,3-8,15-18H2,1-2H3,(H,26,28) |
| InChIKey | UNICCORFNJWMAE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide?
The IUPAC name of N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide (CID 19363251) is N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide.
What is the SMILES notation for N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide?
The canonical SMILES for N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide is CCCCCOc1ccc(C(=O)NCCc2ccc(O)cc2)cc1OCCCCC.
What is the InChIKey of N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide?
The InChIKey is UNICCORFNJWMAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35NO4/c1-3-5-7-17-29-23-14-11-21(19-24(23)30-18-8-6-4-2)25(28)26-16-15-20-9-12-22(27)13-10-20/h9-14,19,27H,3-8,15-18H2,1-2H3,(H,26,28).
What are the key properties of N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide?
N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide has a molecular weight of 413.56 g/mol, XLogP of 5.50, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-hydroxyphenyl)ethyl]-3,4-dipentoxybenzamide is sourced from PubChem (CID 19363251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).