About 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one
4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one (PubChem CID 19363581) has the molecular formula C9H11F2N3O2
and a molecular weight of 231.20 g/mol. Its IUPAC name is 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one |
| PubChem CID | 19363581 |
| Molecular Formula | C9H11F2N3O2 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one |
| SMILES | Nc1ccn(CCC(CO)=C(F)F)c(=O)n1 |
| InChI | InChI=1S/C9H11F2N3O2/c10-8(11)6(5-15)1-3-14-4-2-7(12)13-9(14)16/h2,4,15H,1,3,5H2,(H2,12,13,16) |
| InChIKey | JINQJGUPVIMNCU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one?
The IUPAC name of 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one (CID 19363581) is 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one.
What is the SMILES notation for 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one?
The canonical SMILES for 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one is Nc1ccn(CCC(CO)=C(F)F)c(=O)n1.
What is the InChIKey of 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one?
The InChIKey is JINQJGUPVIMNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2N3O2/c10-8(11)6(5-15)1-3-14-4-2-7(12)13-9(14)16/h2,4,15H,1,3,5H2,(H2,12,13,16).
What are the key properties of 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one?
4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one has a molecular weight of 231.20 g/mol, XLogP of 0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[4,4-difluoro-3-(hydroxymethyl)but-3-enyl]pyrimidin-2-one is sourced from PubChem (CID 19363581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).