About 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene
5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene (PubChem CID 19363778) has the molecular formula C9H12OS
and a molecular weight of 168.26 g/mol. Its IUPAC name is 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene |
| PubChem CID | 19363778 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene |
| SMILES | C=CS(=O)C1(C)C=CC=CC1 |
| InChI | InChI=1S/C9H12OS/c1-3-11(10)9(2)7-5-4-6-8-9/h3-7H,1,8H2,2H3 |
| InChIKey | CUYKDNQYEBQOLK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene?
The IUPAC name of 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene (CID 19363778) is 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene.
What is the SMILES notation for 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene?
The canonical SMILES for 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene is C=CS(=O)C1(C)C=CC=CC1.
What is the InChIKey of 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene?
The InChIKey is CUYKDNQYEBQOLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12OS/c1-3-11(10)9(2)7-5-4-6-8-9/h3-7H,1,8H2,2H3.
What are the key properties of 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene?
5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene has a molecular weight of 168.26 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenylsulfinyl-5-methylcyclohexa-1,3-diene is sourced from PubChem (CID 19363778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).