C24H23FN2O4S — CID 19364250
(Z)-2-(2,1,3-benzothiadiazol-5-yl)-3-(cyclohexylmethyl)-4-(3-fluoro-4-methoxyphenyl)-4-oxobut-2-enoic acid (PubChem CID 19364250) has the molecular formula C24H23FN2O4S and a molecular weight of 454.52 g/mol. Its IUPAC name is (Z)-2-(2,1,3-benzothiadiazol-5-yl)-3-(cyclohexylmethyl)-4-(3-fluoro-4-methoxyphenyl)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-2-(2,1,3-benzothiadiazol-5-yl)-3-(cyclohexylmethyl)-4-(3-fluoro-4-methoxyphenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 19364250 |
| Molecular Formula | C24H23FN2O4S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (Z)-2-(2,1,3-benzothiadiazol-5-yl)-3-(cyclohexylmethyl)-4-(3-fluoro-4-methoxyphenyl)-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(C(=O)/C(CC2CCCCC2)=C(\C(=O)O)c2ccc3nsnc3c2)cc1F |
| InChI | InChI=1S/C24H23FN2O4S/c1-31-21-10-8-16(12-18(21)25)23(28)17(11-14-5-3-2-4-6-14)22(24(29)30)15-7-9-19-20(13-15)27-32-26-19/h7-10,12-14H,2-6,11H2,1H3,(H,29,30)/b22-17- |
| InChIKey | JAGRCEWHCIOCJZ-XLNRJJMWSA-N |
| XLogP | 5.53 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|