C20H11N5OS — CID 1936439
HI-Topk-032 (PubChem CID 1936439) has the molecular formula C20H11N5OS and a molecular weight of 369.40 g/mol. Its IUPAC name is N-(12-cyanoindolizino[2,3-b]quinoxalin-2-yl)thiophene-2-carboxamide.
| Compound Name | HI-Topk-032 |
|---|---|
| PubChem CID | 1936439 |
| Molecular Formula | C20H11N5OS |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | N-(12-cyanoindolizino[2,3-b]quinoxalin-2-yl)thiophene-2-carboxamide |
| SMILES | C1=CC=C2C(=C1)N=C3C(=C4C=C(C=CN4C3=N2)NC(=O)C5=CC=CS5)C#N |
| InChI | InChI=1S/C20H11N5OS/c21-11-13-16-10-12(22-20(26)17-6-3-9-27-17)7-8-25(16)19-18(13)23-14-4-1-2-5-15(14)24-19/h1-10H,(H,22,26) |
| InChIKey | BCSBXWKRZUPFHW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | 635 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |