C13H16F4 — CID 19364579
1-ethenyl-5,5,6,6-tetrafluoro-4-(2-methylbutan-2-yl)cyclohexa-1,3-diene (PubChem CID 19364579) has the molecular formula C13H16F4 and a molecular weight of 248.26 g/mol. Its IUPAC name is 1-ethenyl-5,5,6,6-tetrafluoro-4-(2-methylbutan-2-yl)cyclohexa-1,3-diene.
| Compound Name | 1-ethenyl-5,5,6,6-tetrafluoro-4-(2-methylbutan-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 19364579 |
| Molecular Formula | C13H16F4 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-ethenyl-5,5,6,6-tetrafluoro-4-(2-methylbutan-2-yl)cyclohexa-1,3-diene |
| SMILES | C=CC1=CC=C(C(C)(C)CC)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H16F4/c1-5-9-7-8-10(11(3,4)6-2)13(16,17)12(9,14)15/h5,7-8H,1,6H2,2-4H3 |
| InChIKey | ILCNRNGWZZWUEZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|