About Diethoxysiloxane
Diethoxysiloxane (PubChem CID 19364610) has the molecular formula C4H11O3Si
and a molecular weight of 135.22 g/mol.
Molecular Properties
| Compound Name | Diethoxysiloxane |
| PubChem CID | 19364610 |
| Molecular Formula | C4H11O3Si |
| Molecular Weight | 135.22 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | — |
| SMILES | CCO[Si](O)OCC |
| InChI | InChI=1S/C4H11O3Si/c1-3-6-8(5)7-4-2/h5H,3-4H2,1-2H3 |
| InChIKey | HUJULIUYHSLSQQ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Diethoxysiloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diethoxysiloxane?
The IUPAC name of Diethoxysiloxane (CID 19364610) is not available.
What is the SMILES notation for Diethoxysiloxane?
The canonical SMILES for Diethoxysiloxane is CCO[Si](O)OCC.
What is the InChIKey of Diethoxysiloxane?
The InChIKey is HUJULIUYHSLSQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11O3Si/c1-3-6-8(5)7-4-2/h5H,3-4H2,1-2H3.
What are the key properties of Diethoxysiloxane?
Diethoxysiloxane has a molecular weight of 135.22 g/mol, XLogP of 0.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Diethoxysiloxane is sourced from PubChem (CID 19364610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).