C22H15BrN2O2 — CID 19364867
13-bromo-7-methoxy-3-(pyridin-3-ylmethyl)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaen-4-one (PubChem CID 19364867) has the molecular formula C22H15BrN2O2 and a molecular weight of 419.28 g/mol. Its IUPAC name is 13-bromo-7-methoxy-3-(pyridin-3-ylmethyl)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaen-4-one.
| Compound Name | 13-bromo-7-methoxy-3-(pyridin-3-ylmethyl)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaen-4-one |
|---|---|
| PubChem CID | 19364867 |
| Molecular Formula | C22H15BrN2O2 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 13-bromo-7-methoxy-3-(pyridin-3-ylmethyl)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaen-4-one |
| SMILES | COc1cc2c(=O)c(Cc3cccnc3)cn3c4cc(Br)ccc4c(c1)c23 |
| InChI | InChI=1S/C22H15BrN2O2/c1-27-16-9-18-17-5-4-15(23)8-20(17)25-12-14(7-13-3-2-6-24-11-13)22(26)19(10-16)21(18)25/h2-6,8-12H,7H2,1H3 |
| InChIKey | FJDYUGKPZVJWHT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |