C9H16N2 — CID 19365017
4-methyl-1,2,3,3a,5,7a-hexahydroisoindol-4-amine (PubChem CID 19365017) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 4-methyl-1,2,3,3a,5,7a-hexahydroisoindol-4-amine.
| Compound Name | 4-methyl-1,2,3,3a,5,7a-hexahydroisoindol-4-amine |
|---|---|
| PubChem CID | 19365017 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 4-methyl-1,2,3,3a,5,7a-hexahydroisoindol-4-amine |
| SMILES | CC1(N)CC=CC2CNCC21 |
| InChI | InChI=1S/C9H16N2/c1-9(10)4-2-3-7-5-11-6-8(7)9/h2-3,7-8,11H,4-6,10H2,1H3 |
| InChIKey | CKUSPNXLPOHBGA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|