C14H24N2O2 — CID 19365027
tert-butyl N-(5-methyl-2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl)carbamate (PubChem CID 19365027) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is tert-butyl N-(5-methyl-2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl)carbamate.
| Compound Name | tert-butyl N-(5-methyl-2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl)carbamate |
|---|---|
| PubChem CID | 19365027 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | tert-butyl N-(5-methyl-2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl)carbamate |
| SMILES | CC1C=CC2CNCC2C1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O2/c1-9-5-6-10-7-15-8-11(10)12(9)16-13(17)18-14(2,3)4/h5-6,9-12,15H,7-8H2,1-4H3,(H,16,17) |
| InChIKey | YLFLRZWPZXHNDK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|