C13H22N2O2 — CID 19365035
tert-butyl N-(2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl)carbamate (PubChem CID 19365035) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is tert-butyl N-(2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl)carbamate.
| Compound Name | tert-butyl N-(2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl)carbamate |
|---|---|
| PubChem CID | 19365035 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | tert-butyl N-(2,3,3a,4,5,7a-hexahydro-1H-isoindol-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC=CC2CNCC21 |
| InChI | InChI=1S/C13H22N2O2/c1-13(2,3)17-12(16)15-11-6-4-5-9-7-14-8-10(9)11/h4-5,9-11,14H,6-8H2,1-3H3,(H,15,16) |
| InChIKey | DRNJVUKEDLWMCJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|