About 4-(3,3-dimethoxypropyl)morpholine
4-(3,3-dimethoxypropyl)morpholine (PubChem CID 19365849) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is 4-(3,3-dimethoxypropyl)morpholine.
Molecular Properties
| Compound Name | 4-(3,3-dimethoxypropyl)morpholine |
| PubChem CID | 19365849 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 4-(3,3-dimethoxypropyl)morpholine |
| SMILES | COC(CCN1CCOCC1)OC |
| InChI | InChI=1S/C9H19NO3/c1-11-9(12-2)3-4-10-5-7-13-8-6-10/h9H,3-8H2,1-2H3 |
| InChIKey | FKRQHUCDWCZSBF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3-dimethoxypropyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethoxypropyl)morpholine?
The IUPAC name of 4-(3,3-dimethoxypropyl)morpholine (CID 19365849) is 4-(3,3-dimethoxypropyl)morpholine.
What is the SMILES notation for 4-(3,3-dimethoxypropyl)morpholine?
The canonical SMILES for 4-(3,3-dimethoxypropyl)morpholine is COC(CCN1CCOCC1)OC.
What is the InChIKey of 4-(3,3-dimethoxypropyl)morpholine?
The InChIKey is FKRQHUCDWCZSBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3/c1-11-9(12-2)3-4-10-5-7-13-8-6-10/h9H,3-8H2,1-2H3.
What are the key properties of 4-(3,3-dimethoxypropyl)morpholine?
4-(3,3-dimethoxypropyl)morpholine has a molecular weight of 189.25 g/mol, XLogP of 0.33, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethoxypropyl)morpholine is sourced from PubChem (CID 19365849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).