C7H8BrNS — CID 19365868
2-bromo-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (PubChem CID 19365868) has the molecular formula C7H8BrNS and a molecular weight of 218.12 g/mol. Its IUPAC name is 2-bromo-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
| Compound Name | 2-bromo-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 19365868 |
| Molecular Formula | C7H8BrNS |
| Molecular Weight | 218.12 g/mol |
| Exact Mass | 216.96 |
| IUPAC Name | 2-bromo-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| SMILES | Brc1cc2c(s1)CCNC2 |
| InChI | InChI=1S/C7H8BrNS/c8-7-3-5-4-9-2-1-6(5)10-7/h3,9H,1-2,4H2 |
| InChIKey | DOZQOZIGEUPNHN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.12 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |