C19H18F2N4O2 — CID 19365924
N-[4-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]phenyl]formamide (PubChem CID 19365924) has the molecular formula C19H18F2N4O2 and a molecular weight of 372.38 g/mol. Its IUPAC name is N-[4-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]phenyl]formamide.
| Compound Name | N-[4-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]phenyl]formamide |
|---|---|
| PubChem CID | 19365924 |
| Molecular Formula | C19H18F2N4O2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-[4-[3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]phenyl]formamide |
| SMILES | CC(c1ccc(NC=O)cc1)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H18F2N4O2/c1-13(14-2-5-16(6-3-14)23-12-26)19(27,9-25-11-22-10-24-25)17-7-4-15(20)8-18(17)21/h2-8,10-13,27H,9H2,1H3,(H,23,26) |
| InChIKey | VFNFQWCLUZRNGT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|