C18H34N4O2 — CID 19366072
3,3,5,5-tetramethyl-1-[1-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one (PubChem CID 19366072) has the molecular formula C18H34N4O2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-[1-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one.
| Compound Name | 3,3,5,5-tetramethyl-1-[1-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 19366072 |
| Molecular Formula | C18H34N4O2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-[1-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
| SMILES | CC(N1CC(C)(C)NC(C)(C)C1=O)N1CC(C)(C)NC(C)(C)C1=O |
| InChI | InChI=1S/C18H34N4O2/c1-12(21-10-15(2,3)19-17(6,7)13(21)23)22-11-16(4,5)20-18(8,9)14(22)24/h12,19-20H,10-11H2,1-9H3 |
| InChIKey | SAWPHRJSCQLCAA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |