About propane;1H-pyrimidine-2,4-dione
propane;1H-pyrimidine-2,4-dione (PubChem CID 19366284) has the molecular formula C7H12N2O2
and a molecular weight of 156.19 g/mol. Its IUPAC name is propane;1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | propane;1H-pyrimidine-2,4-dione |
| PubChem CID | 19366284 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | propane;1H-pyrimidine-2,4-dione |
| SMILES | CCC.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H4N2O2.C3H8/c7-3-1-2-5-4(8)6-3;1-3-2/h1-2H,(H2,5,6,7,8);3H2,1-2H3 |
| InChIKey | CWPZHXHUHGXEBR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propane;1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;1H-pyrimidine-2,4-dione?
The IUPAC name of propane;1H-pyrimidine-2,4-dione (CID 19366284) is propane;1H-pyrimidine-2,4-dione.
What is the SMILES notation for propane;1H-pyrimidine-2,4-dione?
The canonical SMILES for propane;1H-pyrimidine-2,4-dione is CCC.O=c1cc[nH]c(=O)[nH]1.
What is the InChIKey of propane;1H-pyrimidine-2,4-dione?
The InChIKey is CWPZHXHUHGXEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.C3H8/c7-3-1-2-5-4(8)6-3;1-3-2/h1-2H,(H2,5,6,7,8);3H2,1-2H3.
What are the key properties of propane;1H-pyrimidine-2,4-dione?
propane;1H-pyrimidine-2,4-dione has a molecular weight of 156.19 g/mol, XLogP of 0.48, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane;1H-pyrimidine-2,4-dione is sourced from PubChem (CID 19366284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).