C37H30N2O2 — CID 19366348
2,6-bis(4-methoxyphenyl)-N,N,3-triphenylpyridin-4-amine (PubChem CID 19366348) has the molecular formula C37H30N2O2 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2,6-bis(4-methoxyphenyl)-N,N,3-triphenylpyridin-4-amine.
| Compound Name | 2,6-bis(4-methoxyphenyl)-N,N,3-triphenylpyridin-4-amine |
|---|---|
| PubChem CID | 19366348 |
| Molecular Formula | C37H30N2O2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 2,6-bis(4-methoxyphenyl)-N,N,3-triphenylpyridin-4-amine |
| SMILES | COc1ccc(-c2cc(N(c3ccccc3)c3ccccc3)c(-c3ccccc3)c(-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C37H30N2O2/c1-40-32-22-18-27(19-23-32)34-26-35(39(30-14-8-4-9-15-30)31-16-10-5-11-17-31)36(28-12-6-3-7-13-28)37(38-34)29-20-24-33(41-2)25-21-29/h3-26H,1-2H3 |
| InChIKey | MQSPQJYWJZLRHF-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |