C5H10N3+ — CID 19366598
1,4,5-trimethyl-1,2,4-triazol-4-ium (PubChem CID 19366598) has the molecular formula C5H10N3+ and a molecular weight of 112.16 g/mol. Its IUPAC name is 1,4,5-trimethyl-1,2,4-triazol-4-ium.
| Compound Name | 1,4,5-trimethyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 19366598 |
| Molecular Formula | C5H10N3+ |
| Molecular Weight | 112.16 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | 1,4,5-trimethyl-1,2,4-triazol-4-ium |
| SMILES | Cc1n(C)nc[n+]1C |
| InChI | InChI=1S/C5H10N3/c1-5-7(2)4-6-8(5)3/h4H,1-3H3/q+1 |
| InChIKey | SJVHMKVCFNCTMA-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.16 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|