About (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene
(2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene (PubChem CID 19366662) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene.
Molecular Properties
| Compound Name | (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene |
| PubChem CID | 19366662 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene |
| SMILES | COC(OC)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C13H24O3/c1-11(2)7-6-8-12(3)9-10-16-13(14-4)15-5/h7,9,13H,6,8,10H2,1-5H3/b12-9+ |
| InChIKey | CIQSGWQFIYDCCL-FMIVXFBMSA-N |
| XLogP | 3.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene?
The IUPAC name of (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene (CID 19366662) is (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene.
What is the SMILES notation for (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene?
The canonical SMILES for (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene is COC(OC)OC/C=C(\C)CCC=C(C)C.
What is the InChIKey of (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene?
The InChIKey is CIQSGWQFIYDCCL-FMIVXFBMSA-N. The full InChI is InChI=1S/C13H24O3/c1-11(2)7-6-8-12(3)9-10-16-13(14-4)15-5/h7,9,13H,6,8,10H2,1-5H3/b12-9+.
What are the key properties of (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene?
(2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene has a molecular weight of 228.33 g/mol, XLogP of 3.27, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-(dimethoxymethoxy)-3,7-dimethylocta-2,6-diene is sourced from PubChem (CID 19366662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).