About 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one
1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one (PubChem CID 19366951) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one |
| PubChem CID | 19366951 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one |
| SMILES | CN1C(=O)CC2(CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C14H18N2O/c1-16-12-5-3-2-4-11(12)14(10-13(16)17)6-8-15-9-7-14/h2-5,15H,6-10H2,1H3 |
| InChIKey | FGRZOAGFJACJEA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one?
The IUPAC name of 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one (CID 19366951) is 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one.
What is the SMILES notation for 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one?
The canonical SMILES for 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one is CN1C(=O)CC2(CCNCC2)c2ccccc21.
What is the InChIKey of 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one?
The InChIKey is FGRZOAGFJACJEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c1-16-12-5-3-2-4-11(12)14(10-13(16)17)6-8-15-9-7-14/h2-5,15H,6-10H2,1H3.
What are the key properties of 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one?
1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one has a molecular weight of 230.31 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylspiro[3H-quinoline-4,4'-piperidine]-2-one is sourced from PubChem (CID 19366951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).