C24H44N4O2 — CID 19367368
(E)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hex-3-enediamide (PubChem CID 19367368) has the molecular formula C24H44N4O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is (E)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hex-3-enediamide.
| Compound Name | (E)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hex-3-enediamide |
|---|---|
| PubChem CID | 19367368 |
| Molecular Formula | C24H44N4O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | (E)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hex-3-enediamide |
| SMILES | CC1(C)CC(NC(=O)C/C=C/CC(=O)NC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C24H44N4O2/c1-21(2)13-17(14-22(3,4)27-21)25-19(29)11-9-10-12-20(30)26-18-15-23(5,6)28-24(7,8)16-18/h9-10,17-18,27-28H,11-16H2,1-8H3,(H,25,29)(H,26,30)/b10-9+ |
| InChIKey | DXZJAWLCRIOVRT-MDZDMXLPSA-N |
| XLogP | 3.17 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|