2-(1-oxoacridin-10-yl)acetyl chloride

C15H10ClNO2 — CID 19367615

IUPAC2-(1-oxoacridin-10-yl)acetyl chloride
SMILESO=C(Cl)Cn1c2cccc(=O)c-2cc2ccccc21
InChIInChI=1S/C15H10ClNO2/c16-15(19)9-17-12-5-2-1-4-10(12)8-11-13(17)6-3-7-14(11)18/h1-8H,9H2
InChIKeyHQRLOAFSDGLMSX-UHFFFAOYSA-N
MW271.70 g/mol
LogP2.87
Rot. Bonds2

About 2-(1-oxoacridin-10-yl)acetyl chloride

2-(1-oxoacridin-10-yl)acetyl chloride (PubChem CID 19367615) has the molecular formula C15H10ClNO2 and a molecular weight of 271.70 g/mol. Its IUPAC name is 2-(1-oxoacridin-10-yl)acetyl chloride.

Molecular Properties

Compound Name2-(1-oxoacridin-10-yl)acetyl chloride
PubChem CID19367615
Molecular FormulaC15H10ClNO2
Molecular Weight271.70 g/mol
Exact Mass271.04
IUPAC Name2-(1-oxoacridin-10-yl)acetyl chloride
SMILESO=C(Cl)Cn1c2cccc(=O)c-2cc2ccccc21
InChIInChI=1S/C15H10ClNO2/c16-15(19)9-17-12-5-2-1-4-10(12)8-11-13(17)6-3-7-14(11)18/h1-8H,9H2
InChIKeyHQRLOAFSDGLMSX-UHFFFAOYSA-N
XLogP2.87
TPSA39.07 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.70
LogP ≤ 52.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze 2-(1-oxoacridin-10-yl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-oxoacridin-10-yl)acetyl chloride?
The IUPAC name of 2-(1-oxoacridin-10-yl)acetyl chloride (CID 19367615) is 2-(1-oxoacridin-10-yl)acetyl chloride.
What is the SMILES notation for 2-(1-oxoacridin-10-yl)acetyl chloride?
The canonical SMILES for 2-(1-oxoacridin-10-yl)acetyl chloride is O=C(Cl)Cn1c2cccc(=O)c-2cc2ccccc21.
What is the InChIKey of 2-(1-oxoacridin-10-yl)acetyl chloride?
The InChIKey is HQRLOAFSDGLMSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClNO2/c16-15(19)9-17-12-5-2-1-4-10(12)8-11-13(17)6-3-7-14(11)18/h1-8H,9H2.
What are the key properties of 2-(1-oxoacridin-10-yl)acetyl chloride?
2-(1-oxoacridin-10-yl)acetyl chloride has a molecular weight of 271.70 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-oxoacridin-10-yl)acetyl chloride is sourced from PubChem (CID 19367615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).