About [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate
[3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate (PubChem CID 19367642) has the molecular formula C30H21N3O5
and a molecular weight of 503.51 g/mol. Its IUPAC name is [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate.
Molecular Properties
| Compound Name | [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate |
| PubChem CID | 19367642 |
| Molecular Formula | C30H21N3O5 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate |
| SMILES | CC1=c2c(cc3c(c2C)N=c2ccccc2=3)N=C1C(=O)Oc1cccc(OCc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C30H21N3O5/c1-17-27-18(2)29(32-26(27)15-24-23-8-3-4-9-25(23)31-28(17)24)30(34)38-22-7-5-6-21(14-22)37-16-19-10-12-20(13-11-19)33(35)36/h3-15H,16H2,1-2H3 |
| InChIKey | DLESBNBMBOGSRS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate?
The IUPAC name of [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate (CID 19367642) is [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate.
What is the SMILES notation for [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate?
The canonical SMILES for [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate is CC1=c2c(cc3c(c2C)N=c2ccccc2=3)N=C1C(=O)Oc1cccc(OCc2ccc([N+](=O)[O-])cc2)c1.
What is the InChIKey of [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate?
The InChIKey is DLESBNBMBOGSRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H21N3O5/c1-17-27-18(2)29(32-26(27)15-24-23-8-3-4-9-25(23)31-28(17)24)30(34)38-22-7-5-6-21(14-22)37-16-19-10-12-20(13-11-19)33(35)36/h3-15H,16H2,1-2H3.
What are the key properties of [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate?
[3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate has a molecular weight of 503.51 g/mol, XLogP of 4.90, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethylpyrrolo[3,2-b]carbazole-2-carboxylate is sourced from PubChem (CID 19367642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).