About 2-chloro-3-methylbenzoyl chloride
2-chloro-3-methylbenzoyl chloride (PubChem CID 19367940) has the molecular formula C8H6Cl2O
and a molecular weight of 189.04 g/mol. Its IUPAC name is 2-chloro-3-methylbenzoyl chloride.
Molecular Properties
| Compound Name | 2-chloro-3-methylbenzoyl chloride |
| PubChem CID | 19367940 |
| Molecular Formula | C8H6Cl2O |
| Molecular Weight | 189.04 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | 2-chloro-3-methylbenzoyl chloride |
| SMILES | Cc1cccc(C(=O)Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl2O/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,1H3 |
| InChIKey | FUUCTBPASNZPKE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.04 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-methylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methylbenzoyl chloride?
The IUPAC name of 2-chloro-3-methylbenzoyl chloride (CID 19367940) is 2-chloro-3-methylbenzoyl chloride.
What is the SMILES notation for 2-chloro-3-methylbenzoyl chloride?
The canonical SMILES for 2-chloro-3-methylbenzoyl chloride is Cc1cccc(C(=O)Cl)c1Cl.
What is the InChIKey of 2-chloro-3-methylbenzoyl chloride?
The InChIKey is FUUCTBPASNZPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2O/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,1H3.
What are the key properties of 2-chloro-3-methylbenzoyl chloride?
2-chloro-3-methylbenzoyl chloride has a molecular weight of 189.04 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methylbenzoyl chloride is sourced from PubChem (CID 19367940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).