About 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one
3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one (PubChem CID 19368214) has the molecular formula C15H16I2N2O2
and a molecular weight of 510.11 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one.
Molecular Properties
| Compound Name | 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one |
| PubChem CID | 19368214 |
| Molecular Formula | C15H16I2N2O2 |
| Molecular Weight | 510.11 g/mol |
| Exact Mass | 509.93 |
| IUPAC Name | 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one |
| SMILES | CCCOc1nc2c(I)cc(I)cc2c(=O)n1CC1CC1 |
| InChI | InChI=1S/C15H16I2N2O2/c1-2-5-21-15-18-13-11(6-10(16)7-12(13)17)14(20)19(15)8-9-3-4-9/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | HGZBBCFVMOJJCC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.11 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one?
The IUPAC name of 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one (CID 19368214) is 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one.
What is the SMILES notation for 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one?
The canonical SMILES for 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one is CCCOc1nc2c(I)cc(I)cc2c(=O)n1CC1CC1.
What is the InChIKey of 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one?
The InChIKey is HGZBBCFVMOJJCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16I2N2O2/c1-2-5-21-15-18-13-11(6-10(16)7-12(13)17)14(20)19(15)8-9-3-4-9/h6-7,9H,2-5,8H2,1H3.
What are the key properties of 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one?
3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one has a molecular weight of 510.11 g/mol, XLogP of 3.80, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopropylmethyl)-6,8-diiodo-2-propoxyquinazolin-4-one is sourced from PubChem (CID 19368214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).