About (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine
(E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine (PubChem CID 19368335) has the molecular formula C16H14F2N2
and a molecular weight of 272.30 g/mol. Its IUPAC name is (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine.
Molecular Properties
| Compound Name | (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine |
| PubChem CID | 19368335 |
| Molecular Formula | C16H14F2N2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine |
| SMILES | Cc1ccc(/C=N/N=C/c2c(F)cc(C)cc2F)cc1 |
| InChI | InChI=1S/C16H14F2N2/c1-11-3-5-13(6-4-11)9-19-20-10-14-15(17)7-12(2)8-16(14)18/h3-10H,1-2H3/b19-9+,20-10+ |
| InChIKey | QYYGNZAKAORRSF-LQGKIZFRSA-N |
| XLogP | 4.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine?
The IUPAC name of (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine (CID 19368335) is (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine.
What is the SMILES notation for (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine?
The canonical SMILES for (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine is Cc1ccc(/C=N/N=C/c2c(F)cc(C)cc2F)cc1.
What is the InChIKey of (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine?
The InChIKey is QYYGNZAKAORRSF-LQGKIZFRSA-N. The full InChI is InChI=1S/C16H14F2N2/c1-11-3-5-13(6-4-11)9-19-20-10-14-15(17)7-12(2)8-16(14)18/h3-10H,1-2H3/b19-9+,20-10+.
What are the key properties of (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine?
(E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine has a molecular weight of 272.30 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(E)-(2,6-difluoro-4-methylphenyl)methylideneamino]-1-(4-methylphenyl)methanimine is sourced from PubChem (CID 19368335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).