About 5-aminobenzene-1,3-disulfonyl fluoride
5-aminobenzene-1,3-disulfonyl fluoride (PubChem CID 19369074) has the molecular formula C6H5F2NO4S2
and a molecular weight of 257.24 g/mol. Its IUPAC name is 5-aminobenzene-1,3-disulfonyl fluoride.
Molecular Properties
| Compound Name | 5-aminobenzene-1,3-disulfonyl fluoride |
| PubChem CID | 19369074 |
| Molecular Formula | C6H5F2NO4S2 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 256.96 |
| IUPAC Name | 5-aminobenzene-1,3-disulfonyl fluoride |
| SMILES | Nc1cc(S(=O)(=O)F)cc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C6H5F2NO4S2/c7-14(10,11)5-1-4(9)2-6(3-5)15(8,12)13/h1-3H,9H2 |
| InChIKey | BEGNCWNGPOGPPO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-aminobenzene-1,3-disulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminobenzene-1,3-disulfonyl fluoride?
The IUPAC name of 5-aminobenzene-1,3-disulfonyl fluoride (CID 19369074) is 5-aminobenzene-1,3-disulfonyl fluoride.
What is the SMILES notation for 5-aminobenzene-1,3-disulfonyl fluoride?
The canonical SMILES for 5-aminobenzene-1,3-disulfonyl fluoride is Nc1cc(S(=O)(=O)F)cc(S(=O)(=O)F)c1.
What is the InChIKey of 5-aminobenzene-1,3-disulfonyl fluoride?
The InChIKey is BEGNCWNGPOGPPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F2NO4S2/c7-14(10,11)5-1-4(9)2-6(3-5)15(8,12)13/h1-3H,9H2.
What are the key properties of 5-aminobenzene-1,3-disulfonyl fluoride?
5-aminobenzene-1,3-disulfonyl fluoride has a molecular weight of 257.24 g/mol, XLogP of 0.59, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminobenzene-1,3-disulfonyl fluoride is sourced from PubChem (CID 19369074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).