About 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one
5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one (PubChem CID 19369200) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one |
| PubChem CID | 19369200 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one |
| SMILES | CC1CC(=O)NC1CC(C)C1OCCO1 |
| InChI | InChI=1S/C11H19NO3/c1-7-6-10(13)12-9(7)5-8(2)11-14-3-4-15-11/h7-9,11H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | HTHPRXCNVSVDLZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one?
The IUPAC name of 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one (CID 19369200) is 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one.
What is the SMILES notation for 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one?
The canonical SMILES for 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one is CC1CC(=O)NC1CC(C)C1OCCO1.
What is the InChIKey of 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one?
The InChIKey is HTHPRXCNVSVDLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-7-6-10(13)12-9(7)5-8(2)11-14-3-4-15-11/h7-9,11H,3-6H2,1-2H3,(H,12,13).
What are the key properties of 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one?
5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one has a molecular weight of 213.28 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(1,3-dioxolan-2-yl)propyl]-4-methylpyrrolidin-2-one is sourced from PubChem (CID 19369200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).