About 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one
5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one (PubChem CID 19369325) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one |
| PubChem CID | 19369325 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one |
| SMILES | CC1CC(=O)NC1C(C)C1OCCO1 |
| InChI | InChI=1S/C10H17NO3/c1-6-5-8(12)11-9(6)7(2)10-13-3-4-14-10/h6-7,9-10H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | DSMFHQKGUCEWRD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one?
The IUPAC name of 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one (CID 19369325) is 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one.
What is the SMILES notation for 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one?
The canonical SMILES for 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one is CC1CC(=O)NC1C(C)C1OCCO1.
What is the InChIKey of 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one?
The InChIKey is DSMFHQKGUCEWRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-6-5-8(12)11-9(6)7(2)10-13-3-4-14-10/h6-7,9-10H,3-5H2,1-2H3,(H,11,12).
What are the key properties of 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one?
5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one has a molecular weight of 199.25 g/mol, XLogP of 0.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one is sourced from PubChem (CID 19369325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).