C21H16ClF5N2O — CID 19369781
4-chloro-1-(2-methylphenyl)-6-(2,2,3,3,3-pentafluoropropoxy)-2,3-dihydropyrrolo[3,2-c]quinoline (PubChem CID 19369781) has the molecular formula C21H16ClF5N2O and a molecular weight of 442.82 g/mol. Its IUPAC name is 4-chloro-1-(2-methylphenyl)-6-(2,2,3,3,3-pentafluoropropoxy)-2,3-dihydropyrrolo[3,2-c]quinoline.
| Compound Name | 4-chloro-1-(2-methylphenyl)-6-(2,2,3,3,3-pentafluoropropoxy)-2,3-dihydropyrrolo[3,2-c]quinoline |
|---|---|
| PubChem CID | 19369781 |
| Molecular Formula | C21H16ClF5N2O |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 4-chloro-1-(2-methylphenyl)-6-(2,2,3,3,3-pentafluoropropoxy)-2,3-dihydropyrrolo[3,2-c]quinoline |
| SMILES | Cc1ccccc1N1CCc2c(Cl)nc3c(OCC(F)(F)C(F)(F)F)cccc3c21 |
| InChI | InChI=1S/C21H16ClF5N2O/c1-12-5-2-3-7-15(12)29-10-9-14-18(29)13-6-4-8-16(17(13)28-19(14)22)30-11-20(23,24)21(25,26)27/h2-8H,9-11H2,1H3 |
| InChIKey | XJJIKHOLIUSUMU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|