C29H50O3S — CID 19369978
(2E,6E,10E,14E)-1-butylsulfonyl-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-ol (PubChem CID 19369978) has the molecular formula C29H50O3S and a molecular weight of 478.78 g/mol. Its IUPAC name is (2E,6E,10E,14E)-1-butylsulfonyl-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-ol.
| Compound Name | (2E,6E,10E,14E)-1-butylsulfonyl-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-ol |
|---|---|
| PubChem CID | 19369978 |
| Molecular Formula | C29H50O3S |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | (2E,6E,10E,14E)-1-butylsulfonyl-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-ol |
| SMILES | CCCCS(=O)(=O)C(O)/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C29H50O3S/c1-8-9-22-33(31,32)29(30)23-28(7)21-13-20-27(6)19-12-18-26(5)17-11-16-25(4)15-10-14-24(2)3/h14,16,18,20,23,29-30H,8-13,15,17,19,21-22H2,1-7H3/b25-16+,26-18+,27-20+,28-23+ |
| InChIKey | HWDLMFXKQWQSJY-HVEYDPHPSA-N |
| XLogP | 8.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|