About tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate
tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate (PubChem CID 19370917) has the molecular formula C21H38N4O3S
and a molecular weight of 426.63 g/mol. Its IUPAC name is tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate.
Molecular Properties
| Compound Name | tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate |
| PubChem CID | 19370917 |
| Molecular Formula | C21H38N4O3S |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate |
| SMILES | CCC(C)(C)c1nc(SCCCCCCC(=O)OC(C)(C)C)n(C(=O)N(C)C)n1 |
| InChI | InChI=1S/C21H38N4O3S/c1-9-21(5,6)17-22-18(25(23-17)19(27)24(7)8)29-15-13-11-10-12-14-16(26)28-20(2,3)4/h9-15H2,1-8H3 |
| InChIKey | PZNOSWNLNZMWDN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate?
The IUPAC name of tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate (CID 19370917) is tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate.
What is the SMILES notation for tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate?
The canonical SMILES for tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate is CCC(C)(C)c1nc(SCCCCCCC(=O)OC(C)(C)C)n(C(=O)N(C)C)n1.
What is the InChIKey of tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate?
The InChIKey is PZNOSWNLNZMWDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38N4O3S/c1-9-21(5,6)17-22-18(25(23-17)19(27)24(7)8)29-15-13-11-10-12-14-16(26)28-20(2,3)4/h9-15H2,1-8H3.
What are the key properties of tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate?
tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate has a molecular weight of 426.63 g/mol, XLogP of 4.88, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 7-[[2-(dimethylcarbamoyl)-5-(2-methylbutan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]heptanoate is sourced from PubChem (CID 19370917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).