About 1-methoxycyclohexa-3,5-diene-1,2-diol
1-methoxycyclohexa-3,5-diene-1,2-diol (PubChem CID 19371245) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 1-methoxycyclohexa-3,5-diene-1,2-diol.
Molecular Properties
| Compound Name | 1-methoxycyclohexa-3,5-diene-1,2-diol |
| PubChem CID | 19371245 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 1-methoxycyclohexa-3,5-diene-1,2-diol |
| SMILES | COC1(O)C=CC=CC1O |
| InChI | InChI=1S/C7H10O3/c1-10-7(9)5-3-2-4-6(7)8/h2-6,8-9H,1H3 |
| InChIKey | OMVMVUZVBQXURG-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxycyclohexa-3,5-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxycyclohexa-3,5-diene-1,2-diol?
The IUPAC name of 1-methoxycyclohexa-3,5-diene-1,2-diol (CID 19371245) is 1-methoxycyclohexa-3,5-diene-1,2-diol.
What is the SMILES notation for 1-methoxycyclohexa-3,5-diene-1,2-diol?
The canonical SMILES for 1-methoxycyclohexa-3,5-diene-1,2-diol is COC1(O)C=CC=CC1O.
What is the InChIKey of 1-methoxycyclohexa-3,5-diene-1,2-diol?
The InChIKey is OMVMVUZVBQXURG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-10-7(9)5-3-2-4-6(7)8/h2-6,8-9H,1H3.
What are the key properties of 1-methoxycyclohexa-3,5-diene-1,2-diol?
1-methoxycyclohexa-3,5-diene-1,2-diol has a molecular weight of 142.15 g/mol, XLogP of -0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxycyclohexa-3,5-diene-1,2-diol is sourced from PubChem (CID 19371245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).