C18H38 — CID 19371269
2,2,3,3,4-pentamethyltridecane (PubChem CID 19371269) has the molecular formula C18H38 and a molecular weight of 254.50 g/mol. Its IUPAC name is 2,2,3,3,4-pentamethyltridecane.
| Compound Name | 2,2,3,3,4-pentamethyltridecane |
|---|---|
| PubChem CID | 19371269 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | 2,2,3,3,4-pentamethyltridecane |
| SMILES | CCCCCCCCCC(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38/c1-8-9-10-11-12-13-14-15-16(2)18(6,7)17(3,4)5/h16H,8-15H2,1-7H3 |
| InChIKey | MDKAXUQFQXWRBU-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|