About tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate
tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate (PubChem CID 19371467) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate |
| PubChem CID | 19371467 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate |
| SMILES | C/C=C/C=C/NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17NO2/c1-5-6-7-8-11-9(12)13-10(2,3)4/h5-8H,1-4H3,(H,11,12)/b6-5+,8-7+ |
| InChIKey | XUKALTRSOXMVKA-BSWSSELBSA-N |
| XLogP | 2.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate?
The IUPAC name of tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate (CID 19371467) is tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate?
The canonical SMILES for tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate is C/C=C/C=C/NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate?
The InChIKey is XUKALTRSOXMVKA-BSWSSELBSA-N. The full InChI is InChI=1S/C10H17NO2/c1-5-6-7-8-11-9(12)13-10(2,3)4/h5-8H,1-4H3,(H,11,12)/b6-5+,8-7+.
What are the key properties of tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate?
tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate has a molecular weight of 183.25 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1E,3E)-penta-1,3-dienyl]carbamate is sourced from PubChem (CID 19371467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).