C25H29N7S — CID 19371576
1-(4-amino-3-pyridinyl)-3-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethyl]thiourea (PubChem CID 19371576) has the molecular formula C25H29N7S and a molecular weight of 459.62 g/mol. Its IUPAC name is 1-(4-amino-3-pyridinyl)-3-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethyl]thiourea.
| Compound Name | 1-(4-amino-3-pyridinyl)-3-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethyl]thiourea |
|---|---|
| PubChem CID | 19371576 |
| Molecular Formula | C25H29N7S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 1-(4-amino-3-pyridinyl)-3-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethyl]thiourea |
| SMILES | Nc1ccncc1NC(=S)NCCN1CCC(=C2c3ccccc3CCn3ccnc32)CC1 |
| InChI | InChI=1S/C25H29N7S/c26-21-5-9-27-17-22(21)30-25(33)29-10-15-31-12-6-19(7-13-31)23-20-4-2-1-3-18(20)8-14-32-16-11-28-24(23)32/h1-5,9,11,16-17H,6-8,10,12-15H2,(H2,26,27)(H2,29,30,33) |
| InChIKey | LSIICROFZPWXHH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|