About 3-ethoxy-3-methyloxetane
3-ethoxy-3-methyloxetane (PubChem CID 19371857) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is 3-ethoxy-3-methyloxetane.
Molecular Properties
| Compound Name | 3-ethoxy-3-methyloxetane |
| PubChem CID | 19371857 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 3-ethoxy-3-methyloxetane |
| SMILES | CCOC1(C)COC1 |
| InChI | InChI=1S/C6H12O2/c1-3-8-6(2)4-7-5-6/h3-5H2,1-2H3 |
| InChIKey | WWXPCUUQBIOYJC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-3-methyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-3-methyloxetane?
The IUPAC name of 3-ethoxy-3-methyloxetane (CID 19371857) is 3-ethoxy-3-methyloxetane.
What is the SMILES notation for 3-ethoxy-3-methyloxetane?
The canonical SMILES for 3-ethoxy-3-methyloxetane is CCOC1(C)COC1.
What is the InChIKey of 3-ethoxy-3-methyloxetane?
The InChIKey is WWXPCUUQBIOYJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c1-3-8-6(2)4-7-5-6/h3-5H2,1-2H3.
What are the key properties of 3-ethoxy-3-methyloxetane?
3-ethoxy-3-methyloxetane has a molecular weight of 116.16 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-3-methyloxetane is sourced from PubChem (CID 19371857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).