About 1-bromo-1,3-dichloropropane
1-bromo-1,3-dichloropropane (PubChem CID 19372433) has the molecular formula C3H5BrCl2
and a molecular weight of 191.88 g/mol. Its IUPAC name is 1-bromo-1,3-dichloropropane.
Molecular Properties
| Compound Name | 1-bromo-1,3-dichloropropane |
| PubChem CID | 19372433 |
| Molecular Formula | C3H5BrCl2 |
| Molecular Weight | 191.88 g/mol |
| Exact Mass | 189.90 |
| IUPAC Name | 1-bromo-1,3-dichloropropane |
| SMILES | ClCCC(Cl)Br |
| InChI | InChI=1S/C3H5BrCl2/c4-3(6)1-2-5/h3H,1-2H2 |
| InChIKey | FYTOHQVGQPKKTD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.88 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-1,3-dichloropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-1,3-dichloropropane?
The IUPAC name of 1-bromo-1,3-dichloropropane (CID 19372433) is 1-bromo-1,3-dichloropropane.
What is the SMILES notation for 1-bromo-1,3-dichloropropane?
The canonical SMILES for 1-bromo-1,3-dichloropropane is ClCCC(Cl)Br.
What is the InChIKey of 1-bromo-1,3-dichloropropane?
The InChIKey is FYTOHQVGQPKKTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5BrCl2/c4-3(6)1-2-5/h3H,1-2H2.
What are the key properties of 1-bromo-1,3-dichloropropane?
1-bromo-1,3-dichloropropane has a molecular weight of 191.88 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-1,3-dichloropropane is sourced from PubChem (CID 19372433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).