C26H31NO2 — CID 19372829
ethyl 3-[6-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]-3-pyridinyl]propanoate (PubChem CID 19372829) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is ethyl 3-[6-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]-3-pyridinyl]propanoate.
| Compound Name | ethyl 3-[6-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]-3-pyridinyl]propanoate |
|---|---|
| PubChem CID | 19372829 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | ethyl 3-[6-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]-3-pyridinyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(C#Cc2ccc3c(c2)C(C)(C)CCC3(C)C)nc1 |
| InChI | InChI=1S/C26H31NO2/c1-6-29-24(28)14-10-20-8-12-21(27-18-20)11-7-19-9-13-22-23(17-19)26(4,5)16-15-25(22,2)3/h8-9,12-13,17-18H,6,10,14-16H2,1-5H3 |
| InChIKey | JFALICHEEBKCHY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|