About 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione
3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione (PubChem CID 19373013) has the molecular formula C10H10N4S
and a molecular weight of 218.29 g/mol. Its IUPAC name is 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione.
Molecular Properties
| Compound Name | 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione |
| PubChem CID | 19373013 |
| Molecular Formula | C10H10N4S |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione |
| SMILES | NC1=CC(N)=C(c2ncccn2)C(=S)C1 |
| InChI | InChI=1S/C10H10N4S/c11-6-4-7(12)9(8(15)5-6)10-13-2-1-3-14-10/h1-4H,5,11-12H2 |
| InChIKey | XGJPIOUGYYJPDZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione?
The IUPAC name of 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione (CID 19373013) is 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione.
What is the SMILES notation for 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione?
The canonical SMILES for 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione is NC1=CC(N)=C(c2ncccn2)C(=S)C1.
What is the InChIKey of 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione?
The InChIKey is XGJPIOUGYYJPDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4S/c11-6-4-7(12)9(8(15)5-6)10-13-2-1-3-14-10/h1-4H,5,11-12H2.
What are the key properties of 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione?
3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione has a molecular weight of 218.29 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-2-pyrimidin-2-ylcyclohexa-2,4-diene-1-thione is sourced from PubChem (CID 19373013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).