About 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane
1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 19373386) has the molecular formula C17H20O3
and a molecular weight of 272.34 g/mol. Its IUPAC name is 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane |
| PubChem CID | 19373386 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | C#CCCCCC12OCC(c3ccccc3)(CO1)CO2 |
| InChI | InChI=1S/C17H20O3/c1-2-3-4-8-11-17-18-12-16(13-19-17,14-20-17)15-9-6-5-7-10-15/h1,5-7,9-10H,3-4,8,11-14H2 |
| InChIKey | LRBLXDDHAILLNL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane?
The IUPAC name of 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane (CID 19373386) is 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane.
What is the SMILES notation for 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane?
The canonical SMILES for 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane is C#CCCCCC12OCC(c3ccccc3)(CO1)CO2.
What is the InChIKey of 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane?
The InChIKey is LRBLXDDHAILLNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O3/c1-2-3-4-8-11-17-18-12-16(13-19-17,14-20-17)15-9-6-5-7-10-15/h1,5-7,9-10H,3-4,8,11-14H2.
What are the key properties of 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane?
1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane has a molecular weight of 272.34 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hex-5-ynyl-4-phenyl-2,6,7-trioxabicyclo[2.2.2]octane is sourced from PubChem (CID 19373386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).