C23H45N5O — CID 19373534
1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]imidazolidin-2-one (PubChem CID 19373534) has the molecular formula C23H45N5O and a molecular weight of 407.65 g/mol. Its IUPAC name is 1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]imidazolidin-2-one.
| Compound Name | 1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 19373534 |
| Molecular Formula | C23H45N5O |
| Molecular Weight | 407.65 g/mol |
| Exact Mass | 407.36 |
| IUPAC Name | 1-(2,2,6,6-tetramethylpiperidin-4-yl)-3-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]ethyl]imidazolidin-2-one |
| SMILES | CC1(C)CC(NCCN2CCN(C3CC(C)(C)NC(C)(C)C3)C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C23H45N5O/c1-20(2)13-17(14-21(3,4)25-20)24-9-10-27-11-12-28(19(27)29)18-15-22(5,6)26-23(7,8)16-18/h17-18,24-26H,9-16H2,1-8H3 |
| InChIKey | ALJGTTVTVZLYHN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |