C12H11F4N3O2 — CID 19373603
3-methyl-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1H-1,2,4-triazol-5-one (PubChem CID 19373603) has the molecular formula C12H11F4N3O2 and a molecular weight of 305.23 g/mol. Its IUPAC name is 3-methyl-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 3-methyl-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 19373603 |
| Molecular Formula | C12H11F4N3O2 |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-methyl-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1H-1,2,4-triazol-5-one |
| SMILES | Cc1n[nH]c(=O)n1-c1ccc(OCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C12H11F4N3O2/c1-7-17-18-11(20)19(7)8-2-4-9(5-3-8)21-6-12(15,16)10(13)14/h2-5,10H,6H2,1H3,(H,18,20) |
| InChIKey | YTTLYQIVPNOSMQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|