C11H9F4N3O2 — CID 19373627
3-methyl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-1,2,4-triazol-5-one (PubChem CID 19373627) has the molecular formula C11H9F4N3O2 and a molecular weight of 291.20 g/mol. Its IUPAC name is 3-methyl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 3-methyl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 19373627 |
| Molecular Formula | C11H9F4N3O2 |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-methyl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-1H-1,2,4-triazol-5-one |
| SMILES | Cc1n[nH]c(=O)n1-c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C11H9F4N3O2/c1-6-16-17-10(19)18(6)7-2-4-8(5-3-7)20-11(14,15)9(12)13/h2-5,9H,1H3,(H,17,19) |
| InChIKey | HHJNNVHVEYPCTN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|