C12H9F5N2O2 — CID 19373639
3-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-1H-imidazol-2-one (PubChem CID 19373639) has the molecular formula C12H9F5N2O2 and a molecular weight of 308.21 g/mol. Its IUPAC name is 3-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-1H-imidazol-2-one.
| Compound Name | 3-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-1H-imidazol-2-one |
|---|---|
| PubChem CID | 19373639 |
| Molecular Formula | C12H9F5N2O2 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 3-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-1H-imidazol-2-one |
| SMILES | O=c1[nH]ccn1-c1ccc(OCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9F5N2O2/c13-11(14,12(15,16)17)7-21-9-3-1-8(2-4-9)19-6-5-18-10(19)20/h1-6H,7H2,(H,18,20) |
| InChIKey | LDJOIAOLAQIDEL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|