C13H9F8N3O2 — CID 19373660
4-[4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-1H-1,2,4-triazol-5-one (PubChem CID 19373660) has the molecular formula C13H9F8N3O2 and a molecular weight of 391.22 g/mol. Its IUPAC name is 4-[4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 19373660 |
| Molecular Formula | C13H9F8N3O2 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 4-[4-(2,2,3,3,4,4,5,5-octafluoropentoxy)phenyl]-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]ncn1-c1ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C13H9F8N3O2/c14-9(15)12(18,19)13(20,21)11(16,17)5-26-8-3-1-7(2-4-8)24-6-22-23-10(24)25/h1-4,6,9H,5H2,(H,23,25) |
| InChIKey | MJCBNFKVHFKITK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|